C16H13NO3 — CID 86537
1,2-Propanedione, 1-phenyl-, 2-(O-benzoyloxime) (PubChem CID 86537) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is [(1-oxo-1-phenylpropan-2-ylidene)amino] benzoate.
| Compound Name | 1,2-Propanedione, 1-phenyl-, 2-(O-benzoyloxime) |
|---|---|
| PubChem CID | 86537 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [(1-oxo-1-phenylpropan-2-ylidene)amino] benzoate |
| SMILES | CC(=NOC(=O)C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C16H13NO3/c1-12(15(18)13-8-4-2-5-9-13)17-20-16(19)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | ZNZDJSGUWLGTLA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | 377 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|