C12H13F3N4S — CID 865373
4-ethyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 865373) has the molecular formula C12H13F3N4S and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-ethyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 865373 |
| Molecular Formula | C12H13F3N4S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-ethyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(CNc2cccc(C(F)(F)F)c2)n[nH]c1=S |
| InChI | InChI=1S/C12H13F3N4S/c1-2-19-10(17-18-11(19)20)7-16-9-5-3-4-8(6-9)12(13,14)15/h3-6,16H,2,7H2,1H3,(H,18,20) |
| InChIKey | ARDIEIQTVFBRKF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|