About N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline
N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline (PubChem CID 86566677) has the molecular formula C23H20N6
and a molecular weight of 380.46 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline |
| PubChem CID | 86566677 |
| Molecular Formula | C23H20N6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline |
| SMILES | CN(C)c1cccc(-c2cnc3ncn(Cc4ccc5ncccc5c4)c3n2)c1 |
| InChI | InChI=1S/C23H20N6/c1-28(2)19-7-3-5-18(12-19)21-13-25-22-23(27-21)29(15-26-22)14-16-8-9-20-17(11-16)6-4-10-24-20/h3-13,15H,14H2,1-2H3 |
| InChIKey | GZMMZGSQUDKURX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline?
The IUPAC name of N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline (CID 86566677) is N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline.
What is the SMILES notation for N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline?
The canonical SMILES for N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline is CN(C)c1cccc(-c2cnc3ncn(Cc4ccc5ncccc5c4)c3n2)c1.
What is the InChIKey of N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline?
The InChIKey is GZMMZGSQUDKURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N6/c1-28(2)19-7-3-5-18(12-19)21-13-25-22-23(27-21)29(15-26-22)14-16-8-9-20-17(11-16)6-4-10-24-20/h3-13,15H,14H2,1-2H3.
What are the key properties of N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline?
N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline has a molecular weight of 380.46 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyrazin-5-yl]aniline is sourced from PubChem (CID 86566677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).