About 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid
5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 86566877) has the molecular formula C10H6Cl2N2O4S2
and a molecular weight of 353.21 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 86566877 |
| Molecular Formula | C10H6Cl2N2O4S2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O4S2/c11-5-2-1-3-6(12)8(5)20(17,18)14-9-7(10(15)16)13-4-19-9/h1-4,14H,(H,15,16) |
| InChIKey | XPQBDDSKRNKDHI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid (CID 86566877) is 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1NS(=O)(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is XPQBDDSKRNKDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2O4S2/c11-5-2-1-3-6(12)8(5)20(17,18)14-9-7(10(15)16)13-4-19-9/h1-4,14H,(H,15,16).
What are the key properties of 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid?
5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 353.21 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-dichlorophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 86566877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).