About 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid
5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 86567419) has the molecular formula C12H9F3N2O4S2
and a molecular weight of 366.34 g/mol. Its IUPAC name is 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 86567419 |
| Molecular Formula | C12H9F3N2O4S2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NS(=O)(=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O4S2/c13-12(14,15)8-4-2-1-3-7(8)5-23(20,21)17-10-9(11(18)19)16-6-22-10/h1-4,6,17H,5H2,(H,18,19) |
| InChIKey | YSOCVWOESNEOHL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid (CID 86567419) is 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1NS(=O)(=O)Cc1ccccc1C(F)(F)F.
What is the InChIKey of 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is YSOCVWOESNEOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3N2O4S2/c13-12(14,15)8-4-2-1-3-7(8)5-23(20,21)17-10-9(11(18)19)16-6-22-10/h1-4,6,17H,5H2,(H,18,19).
What are the key properties of 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid?
5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 366.34 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 86567419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).