C22H25Cl2N3Si — CID 86567562
1-[[1,5-bis(4-chlorophenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane (PubChem CID 86567562) has the molecular formula C22H25Cl2N3Si and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-[[1,5-bis(4-chlorophenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane.
| Compound Name | 1-[[1,5-bis(4-chlorophenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
|---|---|
| PubChem CID | 86567562 |
| Molecular Formula | C22H25Cl2N3Si |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-[[1,5-bis(4-chlorophenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
| SMILES | C[Si]1(C)CCN(Cc2cc(-c3ccc(Cl)cc3)n(-c3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C22H25Cl2N3Si/c1-28(2)13-11-26(12-14-28)16-20-15-22(17-3-5-18(23)6-4-17)27(25-20)21-9-7-19(24)8-10-21/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | SMFLDLVEYHKLAQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|