About [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea
[(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea (PubChem CID 86572564) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea.
Molecular Properties
| Compound Name | [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea |
| PubChem CID | 86572564 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=N\NC(N)=S |
| InChI | InChI=1S/C11H21N3S/c1-7(2)9-5-4-8(3)6-10(9)13-14-11(12)15/h7-9H,4-6H2,1-3H3,(H3,12,14,15)/b13-10+/t8-,9+/m1/s1 |
| InChIKey | ODKCPCNLPOUMDZ-HJFHCXLVSA-N |
| XLogP | 2.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
The IUPAC name of [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea (CID 86572564) is [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea.
What is the SMILES notation for [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
The canonical SMILES for [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea is CC(C)[C@@H]1CC[C@@H](C)C/C1=N\NC(N)=S.
What is the InChIKey of [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
The InChIKey is ODKCPCNLPOUMDZ-HJFHCXLVSA-N. The full InChI is InChI=1S/C11H21N3S/c1-7(2)9-5-4-8(3)6-10(9)13-14-11(12)15/h7-9H,4-6H2,1-3H3,(H3,12,14,15)/b13-10+/t8-,9+/m1/s1.
What are the key properties of [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
[(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea has a molecular weight of 227.38 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea is sourced from PubChem (CID 86572564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).