C48H24N4O8-6 — CID 86572599
4-[10,15-bis(4-carboxylatophenyl)-20-[4-(dioxidomethylidene)cyclohexa-2,5-dien-1-ylidene]porphyrin-24-id-5-yl]benzoate (PubChem CID 86572599) has the molecular formula C48H24N4O8-6 and a molecular weight of 784.74 g/mol. Its IUPAC name is 4-[10,15-bis(4-carboxylatophenyl)-20-[4-(dioxidomethylidene)cyclohexa-2,5-dien-1-ylidene]porphyrin-24-id-5-yl]benzoate.
| Compound Name | 4-[10,15-bis(4-carboxylatophenyl)-20-[4-(dioxidomethylidene)cyclohexa-2,5-dien-1-ylidene]porphyrin-24-id-5-yl]benzoate |
|---|---|
| PubChem CID | 86572599 |
| Molecular Formula | C48H24N4O8-6 |
| Molecular Weight | 784.74 g/mol |
| Exact Mass | 784.16 |
| IUPAC Name | 4-[10,15-bis(4-carboxylatophenyl)-20-[4-(dioxidomethylidene)cyclohexa-2,5-dien-1-ylidene]porphyrin-24-id-5-yl]benzoate |
| SMILES | O=C([O-])c1ccc(/C2=C3\C=CC(=N3)C(=c3ccc(=C([O-])[O-])cc3)c3ccc([n-]3)/C(c3ccc(C(=O)[O-])cc3)=C3/C=CC(=N3)/C(c3ccc(C(=O)[O-])cc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C48H30N4O8/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58/h1-24H,(H6,49,50,51,52,53,54,55,56,57,58,59,60)/p-6/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | RDNYWBHLPWGWIG-LWQDQPMZSA-H |
| XLogP | 0.35 |
| TPSA | 217.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.74 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |