C15H28N2O2 — CID 86573301
4-[(5R,9S,13S)-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol (PubChem CID 86573301) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[(5R,9S,13S)-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol.
| Compound Name | 4-[(5R,9S,13S)-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 86573301 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 4-[(5R,9S,13S)-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
| SMILES | [O-][N+]12CCC[C@H]3CNC(CCCCO)[C@@H](CCC1)[C@H]32 |
| InChI | InChI=1S/C15H28N2O2/c18-10-2-1-7-14-13-6-4-9-17(19)8-3-5-12(11-16-14)15(13)17/h12-16,18H,1-11H2/t12-,13+,14?,15-,17?/m0/s1 |
| InChIKey | SIGQXPZEQRBTMS-AQPXSAIXSA-N |
| XLogP | 1.62 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|