About 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile
2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile (PubChem CID 86573427) has the molecular formula C31H22N2O4
and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile |
| PubChem CID | 86573427 |
| Molecular Formula | C31H22N2O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile |
| SMILES | COc1cc(-c2cc(-c3ccc4ccc5cccc6ccc3c4c56)c(C#N)c(=O)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C31H22N2O4/c1-35-26-13-20(14-27(36-2)30(26)37-3)25-15-23(24(16-32)31(34)33-25)21-11-9-19-8-7-17-5-4-6-18-10-12-22(21)29(19)28(17)18/h4-15H,1-3H3,(H,33,34) |
| InChIKey | NUSMCIILOLAPJU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile?
The IUPAC name of 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile (CID 86573427) is 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile.
What is the SMILES notation for 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile?
The canonical SMILES for 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile is COc1cc(-c2cc(-c3ccc4ccc5cccc6ccc3c4c56)c(C#N)c(=O)[nH]2)cc(OC)c1OC.
What is the InChIKey of 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile?
The InChIKey is NUSMCIILOLAPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22N2O4/c1-35-26-13-20(14-27(36-2)30(26)37-3)25-15-23(24(16-32)31(34)33-25)21-11-9-19-8-7-17-5-4-6-18-10-12-22(21)29(19)28(17)18/h4-15H,1-3H3,(H,33,34).
What are the key properties of 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile?
2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile has a molecular weight of 486.53 g/mol, XLogP of 6.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-pyren-1-yl-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile is sourced from PubChem (CID 86573427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).