About 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol
4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol (PubChem CID 86573473) has the molecular formula C14H30N3O+
and a molecular weight of 256.41 g/mol. Its IUPAC name is 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol.
Molecular Properties
| Compound Name | 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol |
| PubChem CID | 86573473 |
| Molecular Formula | C14H30N3O+ |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol |
| SMILES | C[C@@H]1CCCCCC[C@H](CCCCO)/[NH+]=C(/N)N1 |
| InChI | InChI=1S/C14H29N3O/c1-12-8-4-2-3-5-9-13(10-6-7-11-18)17-14(15)16-12/h12-13,18H,2-11H2,1H3,(H3,15,16,17)/p+1/t12-,13-/m1/s1 |
| InChIKey | GTYWVZYJKSTLND-CHWSQXEVSA-O |
| XLogP | 0.25 |
| TPSA | 72.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol?
The IUPAC name of 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol (CID 86573473) is 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol.
What is the SMILES notation for 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol?
The canonical SMILES for 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol is C[C@@H]1CCCCCC[C@H](CCCCO)/[NH+]=C(/N)N1.
What is the InChIKey of 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol?
The InChIKey is GTYWVZYJKSTLND-CHWSQXEVSA-O. The full InChI is InChI=1S/C14H29N3O/c1-12-8-4-2-3-5-9-13(10-6-7-11-18)17-14(15)16-12/h12-13,18H,2-11H2,1H3,(H3,15,16,17)/p+1/t12-,13-/m1/s1.
What are the key properties of 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol?
4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol has a molecular weight of 256.41 g/mol, XLogP of 0.25, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4R,11R)-2-amino-11-methyl-1-aza-3-azoniacycloundec-2-en-4-yl]butan-1-ol is sourced from PubChem (CID 86573473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).