C24H25N7O3 — CID 86573954
3-[(2R,6S)-2,6-dimethyloxan-4-yl]-6,12-bis(1-methylpyrazol-4-yl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one (PubChem CID 86573954) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 3-[(2R,6S)-2,6-dimethyloxan-4-yl]-6,12-bis(1-methylpyrazol-4-yl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one.
| Compound Name | 3-[(2R,6S)-2,6-dimethyloxan-4-yl]-6,12-bis(1-methylpyrazol-4-yl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
|---|---|
| PubChem CID | 86573954 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-[(2R,6S)-2,6-dimethyloxan-4-yl]-6,12-bis(1-methylpyrazol-4-yl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
| SMILES | C[C@@H]1CC(n2c(=O)nc(-c3cnn(C)c3)c3oc4ccc(-c5cnn(C)c5)nc4c32)C[C@H](C)O1 |
| InChI | InChI=1S/C24H25N7O3/c1-13-7-17(8-14(2)33-13)31-22-21-19(6-5-18(27-21)15-9-25-29(3)11-15)34-23(22)20(28-24(31)32)16-10-26-30(4)12-16/h5-6,9-14,17H,7-8H2,1-4H3/t13-,14+,17? |
| InChIKey | KIOKOKYISCAPLD-VMZNBEPHSA-N |
| XLogP | 3.47 |
| TPSA | 105.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |