C38H56O6S — CID 86573989
methyl (4aR,5R,6aS,6bR,10S,12aR)-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10-(4-methylphenyl)sulfonyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 86573989) has the molecular formula C38H56O6S and a molecular weight of 640.93 g/mol. Its IUPAC name is methyl (4aR,5R,6aS,6bR,10S,12aR)-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10-(4-methylphenyl)sulfonyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aR,5R,6aS,6bR,10S,12aR)-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10-(4-methylphenyl)sulfonyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 86573989 |
| Molecular Formula | C38H56O6S |
| Molecular Weight | 640.93 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | methyl (4aR,5R,6aS,6bR,10S,12aR)-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10-(4-methylphenyl)sulfonyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1=CCC3[C@@]4(C)CC[C@H](OS(=O)(=O)c5ccc(C)cc5)C(C)(C)C4CC[C@@]3(C)[C@]1(C)C[C@H]2O |
| InChI | InChI=1S/C38H56O6S/c1-24-10-12-25(13-11-24)45(41,42)44-31-17-18-35(6)28(34(31,4)5)16-19-36(7)29(35)15-14-26-27-22-33(2,3)20-21-38(27,32(40)43-9)30(39)23-37(26,36)8/h10-14,27-31,39H,15-23H2,1-9H3/t27?,28?,29?,30-,31+,35+,36-,37-,38-/m1/s1 |
| InChIKey | JJUCKFNJOUIXAU-XMLXRXJDSA-N |
| XLogP | 8.01 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.93 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|