C18H19N5O — CID 86574122
2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 86574122) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 86574122 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)c(Oc2nc(N)nc(Nc3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C18H19N5O/c1-11-9-12(2)15(13(3)10-11)24-18-22-16(19)21-17(23-18)20-14-7-5-4-6-8-14/h4-10H,1-3H3,(H3,19,20,21,22,23) |
| InChIKey | MWPNCIGQTGUTPD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |