C37H62O4Si — CID 86574147
methyl (4aR,6aS,6bR,10S,12aR)-10-[tert-butyl(dimethyl)silyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-5-oxo-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 86574147) has the molecular formula C37H62O4Si and a molecular weight of 598.99 g/mol. Its IUPAC name is methyl (4aR,6aS,6bR,10S,12aR)-10-[tert-butyl(dimethyl)silyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-5-oxo-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aR,6aS,6bR,10S,12aR)-10-[tert-butyl(dimethyl)silyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-5-oxo-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 86574147 |
| Molecular Formula | C37H62O4Si |
| Molecular Weight | 598.99 g/mol |
| Exact Mass | 598.44 |
| IUPAC Name | methyl (4aR,6aS,6bR,10S,12aR)-10-[tert-butyl(dimethyl)silyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-5-oxo-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1=CCC3[C@@]4(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2=O |
| InChI | InChI=1S/C37H62O4Si/c1-31(2,3)42(12,13)41-29-17-18-34(8)26(33(29,6)7)16-19-35(9)27(34)15-14-24-25-22-32(4,5)20-21-37(25,30(39)40-11)28(38)23-36(24,35)10/h14,25-27,29H,15-23H2,1-13H3/t25?,26?,27?,29-,34-,35+,36+,37+/m0/s1 |
| InChIKey | CNKNHTQCRKVGHU-UHUWFCIOSA-N |
| XLogP | 9.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.99 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|