About benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+)
benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) (PubChem CID 86574279) has the molecular formula C14H14Cl2N3RuS+
and a molecular weight of 428.33 g/mol. Its IUPAC name is benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+).
Molecular Properties
| Compound Name | benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) |
| PubChem CID | 86574279 |
| Molecular Formula | C14H14Cl2N3RuS+ |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.93 |
| IUPAC Name | benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) |
| SMILES | Cl[Ru+].NC(=S)N/N=C/c1ccc(Cl)cc1.c1ccccc1 |
| InChI | InChI=1S/C8H8ClN3S.C6H6.ClH.Ru/c9-7-3-1-6(2-4-7)5-11-12-8(10)13;1-2-4-6-5-3-1;;/h1-5H,(H3,10,12,13);1-6H;1H;/q;;;+2/p-1/b11-5+;;; |
| InChIKey | CAJRQYUDEBAEKI-WVYPJBOLSA-M |
| XLogP | 3.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+)?
The IUPAC name of benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) (CID 86574279) is benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+).
What is the SMILES notation for benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+)?
The canonical SMILES for benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) is Cl[Ru+].NC(=S)N/N=C/c1ccc(Cl)cc1.c1ccccc1.
What is the InChIKey of benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+)?
The InChIKey is CAJRQYUDEBAEKI-WVYPJBOLSA-M. The full InChI is InChI=1S/C8H8ClN3S.C6H6.ClH.Ru/c9-7-3-1-6(2-4-7)5-11-12-8(10)13;1-2-4-6-5-3-1;;/h1-5H,(H3,10,12,13);1-6H;1H;/q;;;+2/p-1/b11-5+;;;.
What are the key properties of benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+)?
benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) has a molecular weight of 428.33 g/mol, XLogP of 3.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;[(E)-(4-chlorophenyl)methylideneamino]thiourea;chlororuthenium(1+) is sourced from PubChem (CID 86574279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).