C28H27FN2O4S — CID 86574370
6-fluoro-7-[1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid (PubChem CID 86574370) has the molecular formula C28H27FN2O4S and a molecular weight of 506.60 g/mol. Its IUPAC name is 6-fluoro-7-[1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-7-[1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86574370 |
| Molecular Formula | C28H27FN2O4S |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 6-fluoro-7-[1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
| SMILES | COc1ccc(CC2C3=C(CCCC3)CCN2c2cc3c(cc2F)c(=O)c(C(=O)O)c2n3CS2)cc1 |
| InChI | InChI=1S/C28H27FN2O4S/c1-35-18-8-6-16(7-9-18)12-22-19-5-3-2-4-17(19)10-11-30(22)24-14-23-20(13-21(24)29)26(32)25(28(33)34)27-31(23)15-36-27/h6-9,13-14,22H,2-5,10-12,15H2,1H3,(H,33,34) |
| InChIKey | BRHJQRXKZZDAPV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|