About tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate
tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate (PubChem CID 86574420) has the molecular formula C17H18F3NO5
and a molecular weight of 373.33 g/mol. Its IUPAC name is tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate |
| PubChem CID | 86574420 |
| Molecular Formula | C17H18F3NO5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate |
| SMILES | COC(=O)C(O)(c1cn(C(=O)OC(C)(C)C)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO5/c1-15(2,3)26-14(23)21-9-11(10-7-5-6-8-12(10)21)16(24,13(22)25-4)17(18,19)20/h5-9,24H,1-4H3 |
| InChIKey | MUXPKFWOIQZTEJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate?
The IUPAC name of tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate (CID 86574420) is tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate.
What is the SMILES notation for tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate?
The canonical SMILES for tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate is COC(=O)C(O)(c1cn(C(=O)OC(C)(C)C)c2ccccc12)C(F)(F)F.
What is the InChIKey of tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate?
The InChIKey is MUXPKFWOIQZTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3NO5/c1-15(2,3)26-14(23)21-9-11(10-7-5-6-8-12(10)21)16(24,13(22)25-4)17(18,19)20/h5-9,24H,1-4H3.
What are the key properties of tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate?
tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate has a molecular weight of 373.33 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)indole-1-carboxylate is sourced from PubChem (CID 86574420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).