About chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide
chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide (PubChem CID 86574474) has the molecular formula C14H24ClN2Ru
and a molecular weight of 356.88 g/mol. Its IUPAC name is chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide.
Molecular Properties
| Compound Name | chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide |
| PubChem CID | 86574474 |
| Molecular Formula | C14H24ClN2Ru |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide |
| SMILES | C[N-]CCNC.Cc1[c-]cc(C(C)C)cc1.Cl[Ru+2] |
| InChI | InChI=1S/C10H13.C4H11N2.ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;1-5-3-4-6-2;;/h4,6-8H,1-3H3;5H,3-4H2,1-2H3;1H;/q2*-1;;+3/p-1 |
| InChIKey | KKDFPMVRRMJUOC-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide?
The IUPAC name of chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide (CID 86574474) is chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide.
What is the SMILES notation for chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide?
The canonical SMILES for chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide is C[N-]CCNC.Cc1[c-]cc(C(C)C)cc1.Cl[Ru+2].
What is the InChIKey of chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide?
The InChIKey is KKDFPMVRRMJUOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13.C4H11N2.ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;1-5-3-4-6-2;;/h4,6-8H,1-3H3;5H,3-4H2,1-2H3;1H;/q2*-1;;+3/p-1.
What are the key properties of chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide?
chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide has a molecular weight of 356.88 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlororuthenium(2+);methyl-[2-(methylamino)ethyl]azanide;1-methyl-4-propan-2-ylbenzene-6-ide is sourced from PubChem (CID 86574474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).