About carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde
carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde (PubChem CID 86574941) has the molecular formula C13H13CrNO4+3
and a molecular weight of 299.25 g/mol. Its IUPAC name is carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde.
Molecular Properties
| Compound Name | carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde |
| PubChem CID | 86574941 |
| Molecular Formula | C13H13CrNO4+3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde |
| SMILES | CN(C)Cc1ccccc1C=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr+3] |
| InChI | InChI=1S/C10H13NO.3CO.Cr/c1-11(2)7-9-5-3-4-6-10(9)8-12;3*1-2;/h3-6,8H,7H2,1-2H3;;;;/q;;;;+3 |
| InChIKey | BLKTXHHGRCKOEP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde?
The IUPAC name of carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde (CID 86574941) is carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde.
What is the SMILES notation for carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde?
The canonical SMILES for carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde is CN(C)Cc1ccccc1C=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr+3].
What is the InChIKey of carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde?
The InChIKey is BLKTXHHGRCKOEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.3CO.Cr/c1-11(2)7-9-5-3-4-6-10(9)8-12;3*1-2;/h3-6,8H,7H2,1-2H3;;;;/q;;;;+3.
What are the key properties of carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde?
carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde has a molecular weight of 299.25 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium(3+);2-[(dimethylamino)methyl]benzaldehyde is sourced from PubChem (CID 86574941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).