C48H48Cl2N2O8 — CID 86575033
2-chloro-3-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione;3-chloro-2-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione (PubChem CID 86575033) has the molecular formula C48H48Cl2N2O8 and a molecular weight of 851.82 g/mol. Its IUPAC name is 2-chloro-3-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione;3-chloro-2-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione.
| Compound Name | 2-chloro-3-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione;3-chloro-2-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione |
|---|---|
| PubChem CID | 86575033 |
| Molecular Formula | C48H48Cl2N2O8 |
| Molecular Weight | 851.82 g/mol |
| Exact Mass | 850.28 |
| IUPAC Name | 2-chloro-3-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione;3-chloro-2-(3,4-dimethoxyanilino)-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)c3cc4c(cc3C2=O)C(C)(C)CCC4)cc1OC.COc1ccc(NC2=C(Cl)C(=O)c3cc4c(cc3C2=O)CCCC4(C)C)cc1OC |
| InChI | InChI=1S/2C24H24ClNO4/c1-24(2)9-5-6-13-10-15-16(12-17(13)24)22(27)20(25)21(23(15)28)26-14-7-8-18(29-3)19(11-14)30-4;1-24(2)9-5-6-13-10-15-16(12-17(13)24)23(28)21(20(25)22(15)27)26-14-7-8-18(29-3)19(11-14)30-4/h2*7-8,10-12,26H,5-6,9H2,1-4H3 |
| InChIKey | JKAFYUSJBSIKHY-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.82 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|