C17H8F3N5O5S3 — CID 86575125
2-[(5Z)-5-[[6-(2-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 86575125) has the molecular formula C17H8F3N5O5S3 and a molecular weight of 515.48 g/mol. Its IUPAC name is 2-[(5Z)-5-[[6-(2-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[6-(2-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 86575125 |
| Molecular Formula | C17H8F3N5O5S3 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.96 |
| IUPAC Name | 2-[(5Z)-5-[[6-(2-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C/c2c(-c3ccccc3[N+](=O)[O-])nc3sc(C(F)(F)F)nn23)SC1=S |
| InChI | InChI=1S/C17H8F3N5O5S3/c18-17(19,20)14-22-24-9(5-10-13(28)23(6-11(26)27)16(31)32-10)12(21-15(24)33-14)7-3-1-2-4-8(7)25(29)30/h1-5H,6H2,(H,26,27)/b10-5- |
| InChIKey | CVVSJAAQDYMKOK-YHYXMXQVSA-N |
| XLogP | 3.67 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|