About 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole
2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 86575218) has the molecular formula C18H11ClN6S
and a molecular weight of 378.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 86575218 |
| Molecular Formula | C18H11ClN6S |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(-n2ncc(-c3nn4cc(-c5ccccc5)nc4s3)n2)cc1 |
| InChI | InChI=1S/C18H11ClN6S/c19-13-6-8-14(9-7-13)25-20-10-15(22-25)17-23-24-11-16(21-18(24)26-17)12-4-2-1-3-5-12/h1-11H |
| InChIKey | SMUVPOSCQPTVFM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole (CID 86575218) is 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole is Clc1ccc(-n2ncc(-c3nn4cc(-c5ccccc5)nc4s3)n2)cc1.
What is the InChIKey of 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is SMUVPOSCQPTVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClN6S/c19-13-6-8-14(9-7-13)25-20-10-15(22-25)17-23-24-11-16(21-18(24)26-17)12-4-2-1-3-5-12/h1-11H.
What are the key properties of 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 378.85 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)triazol-4-yl]-6-phenylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 86575218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).