C30H37NO3 — CID 86575485
2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 86575485) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 86575485 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1ccc(-c2c(C)c(-c3ccc(C)c(C)c3)c(C(OC(C)(C)C)C(=O)O)c(C)c2N)cc1C |
| InChI | InChI=1S/C30H37NO3/c1-16-10-12-22(14-18(16)3)24-20(5)25(23-13-11-17(2)19(4)15-23)27(31)21(6)26(24)28(29(32)33)34-30(7,8)9/h10-15,28H,31H2,1-9H3,(H,32,33) |
| InChIKey | SOWQWESCDKPPNK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|