C25H32O11 — CID 86575628
(2S,3S,4S,5R,6R)-6-[4-[(2S,3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenoxy]oxane-2,3,4,5-tetrol (PubChem CID 86575628) has the molecular formula C25H32O11 and a molecular weight of 508.52 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[4-[(2S,3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenoxy]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5R,6R)-6-[4-[(2S,3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenoxy]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 86575628 |
| Molecular Formula | C25H32O11 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[4-[(2S,3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenoxy]oxane-2,3,4,5-tetrol |
| SMILES | COc1cc(C[C@H]2CO[C@H](c3ccc(O[C@@H]4O[C@H](O)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c3)[C@H]2CO)ccc1O |
| InChI | InChI=1S/C25H32O11/c1-32-18-8-12(3-5-16(18)27)7-14-11-34-23(15(14)10-26)13-4-6-17(19(9-13)33-2)35-25-22(30)20(28)21(29)24(31)36-25/h3-6,8-9,14-15,20-31H,7,10-11H2,1-2H3/t14-,15-,20-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | TXRSQTOBLHLMAL-HYFBWVPJSA-N |
| XLogP | 0.08 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |