C22H31FN2O2 — CID 86576042
4-[(5R,6R,9R,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 86576042) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 4-[(5R,6R,9R,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6R,9R,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 86576042 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 4-[(5R,6R,9R,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1ccc(F)cc1)[C@@H]23 |
| InChI | InChI=1S/C22H31FN2O2/c23-18-10-8-16(9-11-18)14-25-15-17-4-2-12-24-13-3-5-19(22(17)24)20(25)6-1-7-21(26)27/h8-11,17,19-20,22H,1-7,12-15H2,(H,26,27)/t17-,19-,20-,22+/m1/s1 |
| InChIKey | DFAJSLNBAGWJBM-RQGSJKACSA-N |
| XLogP | 3.76 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |