C31H53N9O6 — CID 86576276
24-butan-2-yl-10,11-dimethyl-21-(2-methylpropyl)-3,4,10,13,14,20,23,26,27-nonazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone (PubChem CID 86576276) has the molecular formula C31H53N9O6 and a molecular weight of 647.82 g/mol. Its IUPAC name is 24-butan-2-yl-10,11-dimethyl-21-(2-methylpropyl)-3,4,10,13,14,20,23,26,27-nonazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone.
| Compound Name | 24-butan-2-yl-10,11-dimethyl-21-(2-methylpropyl)-3,4,10,13,14,20,23,26,27-nonazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
|---|---|
| PubChem CID | 86576276 |
| Molecular Formula | C31H53N9O6 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.41 |
| IUPAC Name | 24-butan-2-yl-10,11-dimethyl-21-(2-methylpropyl)-3,4,10,13,14,20,23,26,27-nonazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
| SMILES | CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C2CCCNN2C(=O)C(C)N(C)C(=O)C2CCCNN2C(=O)C2CCCNN2C1=O |
| InChI | InChI=1S/C31H53N9O6/c1-7-19(4)25-31(46)40-24(13-10-16-34-40)30(45)39-23(12-9-15-33-39)29(44)37(6)20(5)28(43)38-22(11-8-14-32-38)27(42)35-21(17-18(2)3)26(41)36-25/h18-25,32-34H,7-17H2,1-6H3,(H,35,42)(H,36,41) |
| InChIKey | AHVYNRPQGLJIJS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |