C15H26O2 — CID 86576803
(3S,4S)-3-non-8-enyl-4-propyloxetan-2-one (PubChem CID 86576803) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (3S,4S)-3-non-8-enyl-4-propyloxetan-2-one.
| Compound Name | (3S,4S)-3-non-8-enyl-4-propyloxetan-2-one |
|---|---|
| PubChem CID | 86576803 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3S,4S)-3-non-8-enyl-4-propyloxetan-2-one |
| SMILES | C=CCCCCCCC[C@@H]1C(=O)O[C@H]1CCC |
| InChI | InChI=1S/C15H26O2/c1-3-5-6-7-8-9-10-12-13-14(11-4-2)17-15(13)16/h3,13-14H,1,4-12H2,2H3/t13-,14-/m0/s1 |
| InChIKey | VVTDEZQTMNQOPH-KBPBESRZSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|