About N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide
N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 86576805) has the molecular formula C14H10Cl2FN3O2
and a molecular weight of 342.16 g/mol. Its IUPAC name is N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide |
| PubChem CID | 86576805 |
| Molecular Formula | C14H10Cl2FN3O2 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)Nc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C14H10Cl2FN3O2/c15-11-6-5-10(13(16)20-11)19-12(21)7-18-14(22)8-1-3-9(17)4-2-8/h1-6H,7H2,(H,18,22)(H,19,21) |
| InChIKey | HGXMWUZBYQFEPM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide?
The IUPAC name of N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide (CID 86576805) is N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide.
What is the SMILES notation for N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide?
The canonical SMILES for N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide is O=C(CNC(=O)c1ccc(F)cc1)Nc1ccc(Cl)nc1Cl.
What is the InChIKey of N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide?
The InChIKey is HGXMWUZBYQFEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2FN3O2/c15-11-6-5-10(13(16)20-11)19-12(21)7-18-14(22)8-1-3-9(17)4-2-8/h1-6H,7H2,(H,18,22)(H,19,21).
What are the key properties of N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide?
N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide has a molecular weight of 342.16 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,6-dichloro-3-pyridinyl)amino]-2-oxoethyl]-4-fluorobenzamide is sourced from PubChem (CID 86576805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).