C32H30N2O6 — CID 86577248
4-methoxy-6-[(1E,3E,5E)-6-(2H-pyrrol-2-yl)hexa-1,3,5-trienyl]pyran-2-one (PubChem CID 86577248) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is 4-methoxy-6-[(1E,3E,5E)-6-(2H-pyrrol-2-yl)hexa-1,3,5-trienyl]pyran-2-one.
| Compound Name | 4-methoxy-6-[(1E,3E,5E)-6-(2H-pyrrol-2-yl)hexa-1,3,5-trienyl]pyran-2-one |
|---|---|
| PubChem CID | 86577248 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-methoxy-6-[(1E,3E,5E)-6-(2H-pyrrol-2-yl)hexa-1,3,5-trienyl]pyran-2-one |
| SMILES | COc1cc(/C=C/C=C/C=C/C2C=CC=N2)oc(=O)c1.COc1cc(/C=C/C=C/C=C/C2C=CC=N2)oc(=O)c1 |
| InChI | InChI=1S/2C16H15NO3/c2*1-19-15-11-14(20-16(18)12-15)9-5-3-2-4-7-13-8-6-10-17-13/h2*2-13H,1H3/b2*3-2+,7-4+,9-5+ |
| InChIKey | FTUNYTGUXZHXCH-DFEZTGMSSA-N |
| XLogP | 5.57 |
| TPSA | 103.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|