C26H29N3O5S — CID 86577792
N-[4-[6-tert-butyl-8-(2,6-dioxopiperidin-3-yl)-5-methoxyquinolin-3-yl]phenyl]methanesulfonamide (PubChem CID 86577792) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[4-[6-tert-butyl-8-(2,6-dioxopiperidin-3-yl)-5-methoxyquinolin-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[6-tert-butyl-8-(2,6-dioxopiperidin-3-yl)-5-methoxyquinolin-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 86577792 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[4-[6-tert-butyl-8-(2,6-dioxopiperidin-3-yl)-5-methoxyquinolin-3-yl]phenyl]methanesulfonamide |
| SMILES | COc1c(C(C)(C)C)cc(C2CCC(=O)NC2=O)c2ncc(-c3ccc(NS(C)(=O)=O)cc3)cc12 |
| InChI | InChI=1S/C26H29N3O5S/c1-26(2,3)21-13-19(18-10-11-22(30)28-25(18)31)23-20(24(21)34-4)12-16(14-27-23)15-6-8-17(9-7-15)29-35(5,32)33/h6-9,12-14,18,29H,10-11H2,1-5H3,(H,28,30,31) |
| InChIKey | SSHYNCLOLZIZEF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|