About 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol
4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol (PubChem CID 86577948) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol.
Molecular Properties
| Compound Name | 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol |
| PubChem CID | 86577948 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol |
| SMILES | CCc1nc(N)nc(N)c1C#CC(C)c1ccc(-c2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C23H24N4O2/c1-4-20-19(22(24)27-23(25)26-20)11-5-14(2)18-12-8-16(13-21(18)29-3)15-6-9-17(28)10-7-15/h6-10,12-14,28H,4H2,1-3H3,(H4,24,25,26,27) |
| InChIKey | YZAJHNYYMRQZLL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol?
The IUPAC name of 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol (CID 86577948) is 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol.
What is the SMILES notation for 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol?
The canonical SMILES for 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol is CCc1nc(N)nc(N)c1C#CC(C)c1ccc(-c2ccc(O)cc2)cc1OC.
What is the InChIKey of 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol?
The InChIKey is YZAJHNYYMRQZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-4-20-19(22(24)27-23(25)26-20)11-5-14(2)18-12-8-16(13-21(18)29-3)15-6-9-17(28)10-7-15/h6-10,12-14,28H,4H2,1-3H3,(H4,24,25,26,27).
What are the key properties of 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol?
4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol has a molecular weight of 388.47 g/mol, XLogP of 3.74, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]phenol is sourced from PubChem (CID 86577948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).