About methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate
methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate (PubChem CID 86578162) has the molecular formula C25H26N4O3
and a molecular weight of 430.51 g/mol. Its IUPAC name is methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate |
| PubChem CID | 86578162 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate |
| SMILES | CCc1nc(N)nc(N)c1C#CC(C)c1ccc(-c2ccc(C(=O)OC)cc2)cc1OC |
| InChI | InChI=1S/C25H26N4O3/c1-5-21-20(23(26)29-25(27)28-21)12-6-15(2)19-13-11-18(14-22(19)31-3)16-7-9-17(10-8-16)24(30)32-4/h7-11,13-15H,5H2,1-4H3,(H4,26,27,28,29) |
| InChIKey | NAQVHWHJQHENSF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate?
The IUPAC name of methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate (CID 86578162) is methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate.
What is the SMILES notation for methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate?
The canonical SMILES for methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate is CCc1nc(N)nc(N)c1C#CC(C)c1ccc(-c2ccc(C(=O)OC)cc2)cc1OC.
What is the InChIKey of methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate?
The InChIKey is NAQVHWHJQHENSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N4O3/c1-5-21-20(23(26)29-25(27)28-21)12-6-15(2)19-13-11-18(14-22(19)31-3)16-7-9-17(10-8-16)24(30)32-4/h7-11,13-15H,5H2,1-4H3,(H4,26,27,28,29).
What are the key properties of methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate?
methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate has a molecular weight of 430.51 g/mol, XLogP of 3.82, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[4-(2,4-diamino-6-ethylpyrimidin-5-yl)but-3-yn-2-yl]-3-methoxyphenyl]benzoate is sourced from PubChem (CID 86578162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).