C37H38F4N4O5 — CID 86578171
[(3S,6R)-6-[2-[2-[[(2S,3R)-2-amino-3-(4-phenoxyphenyl)-3-phenylpropanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 86578171) has the molecular formula C37H38F4N4O5 and a molecular weight of 694.73 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[2-[[(2S,3R)-2-amino-3-(4-phenoxyphenyl)-3-phenylpropanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[2-[[(2S,3R)-2-amino-3-(4-phenoxyphenyl)-3-phenylpropanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 86578171 |
| Molecular Formula | C37H38F4N4O5 |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | [(3S,6R)-6-[2-[2-[[(2S,3R)-2-amino-3-(4-phenoxyphenyl)-3-phenylpropanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | N[C@H](C(=O)Nc1cccc(F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1)[C@H](c1ccccc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C37H38F4N4O5/c38-31-12-7-13-32(30(31)19-18-29-20-43-26(21-48-29)22-49-36(47)44-23-37(39,40)41)45-35(46)34(42)33(24-8-3-1-4-9-24)25-14-16-28(17-15-25)50-27-10-5-2-6-11-27/h1-17,26,29,33-34,43H,18-23,42H2,(H,44,47)(H,45,46)/t26-,29+,33+,34-/m0/s1 |
| InChIKey | YINPSMUQUXYZNN-GGVCPTBUSA-N |
| XLogP | 6.29 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |