C37H37F5N4O5 — CID 86578205
[(3S,6R)-6-[2-[2-[[(2S,3S)-2-amino-3-(4-fluorophenyl)-3-(4-phenoxyphenyl)propanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 86578205) has the molecular formula C37H37F5N4O5 and a molecular weight of 712.72 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[2-[[(2S,3S)-2-amino-3-(4-fluorophenyl)-3-(4-phenoxyphenyl)propanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[2-[[(2S,3S)-2-amino-3-(4-fluorophenyl)-3-(4-phenoxyphenyl)propanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 86578205 |
| Molecular Formula | C37H37F5N4O5 |
| Molecular Weight | 712.72 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | [(3S,6R)-6-[2-[2-[[(2S,3S)-2-amino-3-(4-fluorophenyl)-3-(4-phenoxyphenyl)propanoyl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | N[C@H](C(=O)Nc1cccc(F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1)[C@H](c1ccc(F)cc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C37H37F5N4O5/c38-25-13-9-23(10-14-25)33(24-11-15-28(16-12-24)51-27-5-2-1-3-6-27)34(43)35(47)46-32-8-4-7-31(39)30(32)18-17-29-19-44-26(20-49-29)21-50-36(48)45-22-37(40,41)42/h1-16,26,29,33-34,44H,17-22,43H2,(H,45,48)(H,46,47)/t26-,29+,33+,34-/m0/s1 |
| InChIKey | CGTRZBMCEXCRHK-GGVCPTBUSA-N |
| XLogP | 6.43 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.72 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |