C33H37F3N4O6 — CID 86578263
methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[2-[2-[(2R,5S)-5-(2,2,2-trifluoroethylcarbamoyloxymethyl)morpholin-2-yl]ethyl]anilino]propan-2-yl]carbamate (PubChem CID 86578263) has the molecular formula C33H37F3N4O6 and a molecular weight of 642.68 g/mol. Its IUPAC name is methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[2-[2-[(2R,5S)-5-(2,2,2-trifluoroethylcarbamoyloxymethyl)morpholin-2-yl]ethyl]anilino]propan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[2-[2-[(2R,5S)-5-(2,2,2-trifluoroethylcarbamoyloxymethyl)morpholin-2-yl]ethyl]anilino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 86578263 |
| Molecular Formula | C33H37F3N4O6 |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[2-[2-[(2R,5S)-5-(2,2,2-trifluoroethylcarbamoyloxymethyl)morpholin-2-yl]ethyl]anilino]propan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)Nc1ccccc1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37F3N4O6/c1-44-32(43)40-29(28(23-11-4-2-5-12-23)24-13-6-3-7-14-24)30(41)39-27-15-9-8-10-22(27)16-17-26-18-37-25(19-45-26)20-46-31(42)38-21-33(34,35)36/h2-15,25-26,28-29,37H,16-21H2,1H3,(H,38,42)(H,39,41)(H,40,43)/t25-,26+,29-/m0/s1 |
| InChIKey | PVNUMLKYPRPZHY-HFASVGIHSA-N |
| XLogP | 4.76 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |