C26H23N5O4 — CID 86579166
7-benzyl-1-cyclohexyl-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 86579166) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is 7-benzyl-1-cyclohexyl-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 7-benzyl-1-cyclohexyl-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 86579166 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 7-benzyl-1-cyclohexyl-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | O=c1[nH]c2cc3nc(-c4ccc([N+](=O)[O-])o4)n(C4CCCCC4)c3cc2nc1Cc1ccccc1 |
| InChI | InChI=1S/C26H23N5O4/c32-26-21(13-16-7-3-1-4-8-16)27-19-15-22-20(14-18(19)29-26)28-25(23-11-12-24(35-23)31(33)34)30(22)17-9-5-2-6-10-17/h1,3-4,7-8,11-12,14-15,17H,2,5-6,9-10,13H2,(H,29,32) |
| InChIKey | QXKQOMBASQAKAB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|