About 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one
1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 86579189) has the molecular formula C15H17FN4O3
and a molecular weight of 320.32 g/mol. Its IUPAC name is 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one |
| PubChem CID | 86579189 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | [N-]=[N+]=NCCCCCN1C(=O)C2(OCCO2)c2cc(F)ccc21 |
| InChI | InChI=1S/C15H17FN4O3/c16-11-4-5-13-12(10-11)15(22-8-9-23-15)14(21)20(13)7-3-1-2-6-18-19-17/h4-5,10H,1-3,6-9H2 |
| InChIKey | XNPDJRZUFNMRQA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one?
The IUPAC name of 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one (CID 86579189) is 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one is [N-]=[N+]=NCCCCCN1C(=O)C2(OCCO2)c2cc(F)ccc21.
What is the InChIKey of 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one?
The InChIKey is XNPDJRZUFNMRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN4O3/c16-11-4-5-13-12(10-11)15(22-8-9-23-15)14(21)20(13)7-3-1-2-6-18-19-17/h4-5,10H,1-3,6-9H2.
What are the key properties of 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one?
1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one has a molecular weight of 320.32 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(5-azidopentyl)-5'-fluorospiro[1,3-dioxolane-2,3'-indole]-2'-one is sourced from PubChem (CID 86579189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).