C23H26F2N8O2+2 — CID 86580019
(2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methoxy-3-pyridinyl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580019) has the molecular formula C23H26F2N8O2+2 and a molecular weight of 484.51 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methoxy-3-pyridinyl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methoxy-3-pyridinyl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580019 |
| Molecular Formula | C23H26F2N8O2+2 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methoxy-3-pyridinyl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | COc1ccncc1-c1nc2[n+]([nH]1)CCN([C@H](C)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F)C2 |
| InChI | InChI=1S/C23H24F2N8O2/c1-15(23(34,12-32-14-27-13-28-32)18-4-3-16(24)9-19(18)25)31-7-8-33-21(11-31)29-22(30-33)17-10-26-6-5-20(17)35-2/h3-6,9-10,13-15,34H,7-8,11-12H2,1-2H3/p+2/t15-,23-/m1/s1 |
| InChIKey | XJJFHHZMCOGMSH-IQMFZBJNSA-P |
| XLogP | 0.85 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|