C23H48O28P6 — CID 86580074
[(2R)-2-heptanoyloxy-3-[hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxypropyl] heptanoate (PubChem CID 86580074) has the molecular formula C23H48O28P6 and a molecular weight of 958.45 g/mol. Its IUPAC name is [(2R)-2-heptanoyloxy-3-[hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxypropyl] heptanoate.
| Compound Name | [(2R)-2-heptanoyloxy-3-[hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxypropyl] heptanoate |
|---|---|
| PubChem CID | 86580074 |
| Molecular Formula | C23H48O28P6 |
| Molecular Weight | 958.45 g/mol |
| Exact Mass | 958.08 |
| IUPAC Name | [(2R)-2-heptanoyloxy-3-[hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxypropyl] heptanoate |
| SMILES | CCCCCCC(=O)OC[C@H](COP(=O)(O)OC1[C@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)C(OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1OP(=O)(O)O)OC(=O)CCCCCC |
| InChI | InChI=1S/C23H48O28P6/c1-3-5-7-9-11-16(24)43-13-15(45-17(25)12-10-8-6-4-2)14-44-57(41,42)51-23-21(49-55(35,36)37)19(47-53(29,30)31)18(46-52(26,27)28)20(48-54(32,33)34)22(23)50-56(38,39)40/h15,18-23H,3-14H2,1-2H3,(H,41,42)(H2,26,27,28)(H2,29,30,31)(H2,32,33,34)(H2,35,36,37)(H2,38,39,40)/t15-,18?,19-,20+,21-,22-,23?/m1/s1 |
| InChIKey | ZRPMZUHDMAHLAJ-ATIIMVTASA-N |
| XLogP | 1.29 |
| TPSA | 442.16 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|