C28H34F2N6O+2 — CID 86580108
(2R,3R)-3-[2-(4-tert-butylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580108) has the molecular formula C28H34F2N6O+2 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2R,3R)-3-[2-(4-tert-butylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-3-[2-(4-tert-butylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580108 |
| Molecular Formula | C28H34F2N6O+2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | (2R,3R)-3-[2-(4-tert-butylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | C[C@@H](N1CC[n+]2cc(-c3ccc(C(C)(C)C)cc3)[nH]c2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H32F2N6O/c1-19(28(37,16-36-18-31-17-32-36)23-10-9-22(29)13-24(23)30)34-11-12-35-14-25(33-26(35)15-34)20-5-7-21(8-6-20)27(2,3)4/h5-10,13-14,17-19,37H,11-12,15-16H2,1-4H3/p+2/t19-,28-/m1/s1 |
| InChIKey | AZVWADIUXWDIEO-WHLCRQNOSA-P |
| XLogP | 3.35 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|