C25H25F5N6O+2 — CID 86580129
(2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-[4-(trifluoromethyl)phenyl]-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol (PubChem CID 86580129) has the molecular formula C25H25F5N6O+2 and a molecular weight of 520.51 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-[4-(trifluoromethyl)phenyl]-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-[4-(trifluoromethyl)phenyl]-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol |
|---|---|
| PubChem CID | 86580129 |
| Molecular Formula | C25H25F5N6O+2 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-[4-(trifluoromethyl)phenyl]-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol |
| SMILES | C[C@@H](N1CC[n+]2cc(-c3ccc(C(F)(F)F)cc3)[nH]c2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H23F5N6O/c1-16(24(37,13-36-15-31-14-32-36)20-7-6-19(26)10-21(20)27)34-8-9-35-11-22(33-23(35)12-34)17-2-4-18(5-3-17)25(28,29)30/h2-7,10-11,14-16,37H,8-9,12-13H2,1H3/p+2/t16-,24-/m1/s1 |
| InChIKey | WLWPPKSLVGUSSS-VOIUYBSRSA-P |
| XLogP | 3.07 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|