C25H28F2N6O+2 — CID 86580151
(2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580151) has the molecular formula C25H28F2N6O+2 and a molecular weight of 466.54 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580151 |
| Molecular Formula | C25H28F2N6O+2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | Cc1ccc(-c2c[n+]3c([nH]2)CN([C@H](C)[C@](O)(C[n+]2cnc[nH]2)c2ccc(F)cc2F)CC3)cc1 |
| InChI | InChI=1S/C25H26F2N6O/c1-17-3-5-19(6-4-17)23-12-32-10-9-31(13-24(32)30-23)18(2)25(34,14-33-16-28-15-29-33)21-8-7-20(26)11-22(21)27/h3-8,11-12,15-16,18,34H,9-10,13-14H2,1-2H3/p+2/t18-,25-/m1/s1 |
| InChIKey | SJKKPFZUUSNDQW-IQGLISFBSA-P |
| XLogP | 2.36 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|