C24H26F2N6O+2 — CID 86580172
(2R,3R)-2-(2,4-difluorophenyl)-3-(2-phenyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580172) has the molecular formula C24H26F2N6O+2 and a molecular weight of 452.51 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-(2-phenyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(2-phenyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580172 |
| Molecular Formula | C24H26F2N6O+2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(2-phenyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | C[C@@H](N1CC[n+]2cc(-c3ccccc3)[nH]c2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F2N6O/c1-17(24(33,14-32-16-27-15-28-32)20-8-7-19(25)11-21(20)26)30-9-10-31-12-22(29-23(31)13-30)18-5-3-2-4-6-18/h2-8,11-12,15-17,33H,9-10,13-14H2,1H3/p+2/t17-,24-/m1/s1 |
| InChIKey | HRCFHTIERLILCO-MZNJEOGPSA-P |
| XLogP | 2.05 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|