C17H21F2N7O+2 — CID 86580198
(2R,3R)-2-(2,4-difluorophenyl)-3-(3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580198) has the molecular formula C17H21F2N7O+2 and a molecular weight of 377.40 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-(3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580198 |
| Molecular Formula | C17H21F2N7O+2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | C[C@@H](N1CC[n+]2[nH]cnc2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H19F2N7O/c1-12(24-4-5-26-16(7-24)21-10-23-26)17(27,8-25-11-20-9-22-25)14-3-2-13(18)6-15(14)19/h2-3,6,9-12,27H,4-5,7-8H2,1H3/p+2/t12-,17-/m1/s1 |
| InChIKey | HHLQPEFRDAGHNS-SJKOYZFVSA-P |
| XLogP | -0.22 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|