C17H17N5O3S — CID 86580301
4-(2-methoxyphenyl)-6-[3-(sulfamoylamino)anilino]pyrimidine (PubChem CID 86580301) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-6-[3-(sulfamoylamino)anilino]pyrimidine.
| Compound Name | 4-(2-methoxyphenyl)-6-[3-(sulfamoylamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 86580301 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(2-methoxyphenyl)-6-[3-(sulfamoylamino)anilino]pyrimidine |
| SMILES | COc1ccccc1-c1cc(Nc2cccc(NS(N)(=O)=O)c2)ncn1 |
| InChI | InChI=1S/C17H17N5O3S/c1-25-16-8-3-2-7-14(16)15-10-17(20-11-19-15)21-12-5-4-6-13(9-12)22-26(18,23)24/h2-11,22H,1H3,(H2,18,23,24)(H,19,20,21) |
| InChIKey | CLNKTAGHOZUCSU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |