C24H25N5 — CID 86580359
4-N-cyclohexyl-5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 86580359) has the molecular formula C24H25N5 and a molecular weight of 383.50 g/mol. Its IUPAC name is 4-N-cyclohexyl-5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86580359 |
| Molecular Formula | C24H25N5 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 4-N-cyclohexyl-5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NC2CCCCC2)c2c(-c3ccccc3)c(-c3ccccc3)[nH]c2n1 |
| InChI | InChI=1S/C24H25N5/c25-24-28-22(26-18-14-8-3-9-15-18)20-19(16-10-4-1-5-11-16)21(27-23(20)29-24)17-12-6-2-7-13-17/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H4,25,26,27,28,29) |
| InChIKey | FPNOXHURARDDEA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |