C38H54IN4O2P — CID 86580405
3-[5-[(2E)-1,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-3-yl]pentoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile iodide (PubChem CID 86580405) has the molecular formula C38H54IN4O2P and a molecular weight of 756.75 g/mol. Its IUPAC name is 3-[5-[(2E)-1,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-3-yl]pentoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile iodide.
| Compound Name | 3-[5-[(2E)-1,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-3-yl]pentoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile iodide |
|---|---|
| PubChem CID | 86580405 |
| Molecular Formula | C38H54IN4O2P |
| Molecular Weight | 756.75 g/mol |
| Exact Mass | 756.30 |
| IUPAC Name | 3-[5-[(2E)-1,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-3-yl]pentoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile iodide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCCCCC1(C)/C(=C\C=C\C2=[N+](C)c3ccccc3C2(C)C)N(C)c2ccccc21.[I-] |
| InChI | InChI=1S/C38H54N4O2P.HI/c1-29(2)42(30(3)4)45(44-28-18-26-39)43-27-16-10-15-25-38(7)32-20-12-14-22-34(32)41(9)36(38)24-17-23-35-37(5,6)31-19-11-13-21-33(31)40(35)8;/h11-14,17,19-24,29-30H,10,15-16,18,25,27-28H2,1-9H3;1H/q+1;/p-1 |
| InChIKey | MAKCXYOMZLZGIL-UHFFFAOYSA-M |
| XLogP | 6.40 |
| TPSA | 51.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|