C18H18F2N4O2S — CID 86580541
2-(2,6-difluorophenyl)-2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]acetonitrile (PubChem CID 86580541) has the molecular formula C18H18F2N4O2S and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]acetonitrile.
| Compound Name | 2-(2,6-difluorophenyl)-2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 86580541 |
| Molecular Formula | C18H18F2N4O2S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]acetonitrile |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(=C(C#N)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C18H18F2N4O2S/c1-11-18(12(2)23-22-11)27(25,26)24-8-6-13(7-9-24)14(10-21)17-15(19)4-3-5-16(17)20/h3-5H,6-9H2,1-2H3,(H,22,23) |
| InChIKey | SIKDDFXGAULCSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|