C18H9F7N4O2 — CID 86580620
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(5-fluoro-3-pyridinyl)prop-2-enoic acid (PubChem CID 86580620) has the molecular formula C18H9F7N4O2 and a molecular weight of 446.28 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(5-fluoro-3-pyridinyl)prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(5-fluoro-3-pyridinyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 86580620 |
| Molecular Formula | C18H9F7N4O2 |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(5-fluoro-3-pyridinyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncc(F)c1 |
| InChI | InChI=1S/C18H9F7N4O2/c19-13-3-10(5-26-6-13)14(16(30)31)7-29-8-27-15(28-29)9-1-11(17(20,21)22)4-12(2-9)18(23,24)25/h1-8H,(H,30,31)/b14-7+ |
| InChIKey | HHTKCQQEPRWTST-VGOFMYFVSA-N |
| XLogP | 4.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|